CAS 1638591-44-2 appears in our catalog under these names: 5-Fluoro-1-methyl-1h-indazole-3-carboxamide, 95%, 5-Fluoro-1-methyl-1H-indazole-3-carboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
5-fluoro-1-methylindazole-3-carboxamide (CAS 1638591-44-2) is a chemical compound with the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. IUPAC name: 5-fluoro-1-methylindazole-3-carboxamide. InChIKey: GDGNASXSZYDGJM-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | 5-fluoro-1-methylindazole-3-carboxamide |
| InChIKey | GDGNASXSZYDGJM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)F)C(=N1)C(=O)N |
Computed by PubChem (NCBI)