CAS 860650-96-0 appears in our catalog under these names: 4-(4-fluorophenyl)-5-methyl-2H-1,2,4-triazol-3-one, 95%, 4-(4-Fluorophenyl)-3-methyl-1H-1,2,4-triazol-5(4H)-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-(4-fluorophenyl)-3-methyl-1H-1,2,4-triazol-5-one (CAS 860650-96-0) is a chemical compound with the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. IUPAC name: 4-(4-fluorophenyl)-3-methyl-1H-1,2,4-triazol-5-one. InChIKey: BATKZKFLRJTOLB-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-3-methyl-1H-1,2,4-triazol-5-one |
| InChIKey | BATKZKFLRJTOLB-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=O)N1C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)