CAS 1096130-65-2 is the registry number for [1-(3-Fluorophenyl)-1h-1,2,3-triazol-4-yl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[1-(3-fluorophenyl)triazol-4-yl]methanol (CAS 1096130-65-2) is a chemical compound with the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. IUPAC name: [1-(3-fluorophenyl)triazol-4-yl]methanol. InChIKey: VTRWXKRQCFFJJF-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | [1-(3-fluorophenyl)triazol-4-yl]methanol |
| InChIKey | VTRWXKRQCFFJJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C=C(N=N2)CO |
Computed by PubChem (NCBI)