CAS 1016696-49-3 is the registry number for 4-((Propane-1-sulfonamido)methyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(propylsulfonylamino)methyl]benzenesulfonyl chloride (CAS 1016696-49-3) is a chemical compound with the molecular formula C10H14ClNO4S2 and a molecular weight of 311.8 g/mol. IUPAC name: 4-[(propylsulfonylamino)methyl]benzenesulfonyl chloride. InChIKey: UVTWTLUVLMNEKY-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO4S2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 4-[(propylsulfonylamino)methyl]benzenesulfonyl chloride |
| InChIKey | UVTWTLUVLMNEKY-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)NCC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)