Products 744242-86-2

CAS 744242-86-2 appears in our catalog under these names: 4-[(Diethylamino)sulfonyl]benzenesulfonyl chloride, 95%, 4-(Diethylsulfamoyl)benzene-1-sulfonyl chloride, 95%, 4-(Diethylsulfamoyl)benzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(diethylsulfamoyl)benzenesulfonyl chloride (CAS 744242-86-2) is a chemical compound with the molecular formula C10H14ClNO4S2 and a molecular weight of 311.8 g/mol. IUPAC name: 4-(diethylsulfamoyl)benzenesulfonyl chloride. InChIKey: RTTMYWGQXRVHBR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO4S2
Molecular weight311.8 g/mol
IUPAC name4-(diethylsulfamoyl)benzenesulfonyl chloride
InChIKeyRTTMYWGQXRVHBR-UHFFFAOYSA-N
SMILESCCN(CC)S(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)