Products 1016723-92-4
CAS 1016723-92-4 appears in our catalog under these names: 4-((2-Methylpropyl)sulfamoyl)benzene-1-sulfonyl chloride, 4-((2-Methylpropyl)sulfamoyl)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
4-(2-methylpropylsulfamoyl)benzenesulfonyl chloride (CAS 1016723-92-4) is a chemical compound with the molecular formula C10H14ClNO4S2 and a molecular weight of 311.8 g/mol. IUPAC name: 4-(2-methylpropylsulfamoyl)benzenesulfonyl chloride. InChIKey: FNMXYDGPQHCAGI-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO4S2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 4-(2-methylpropylsulfamoyl)benzenesulfonyl chloride |
| InChIKey | FNMXYDGPQHCAGI-UHFFFAOYSA-N |
| SMILES | CC(C)CNS(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)