Products 953884-53-2

CAS 953884-53-2 appears in our catalog under these names: 3-(Diethylsulfamoyl)benzene-1-sulfonyl chloride, 95%, 3-(Diethylsulfamoyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

3-(diethylsulfamoyl)benzenesulfonyl chloride (CAS 953884-53-2) is a chemical compound with the molecular formula C10H14ClNO4S2 and a molecular weight of 311.8 g/mol. IUPAC name: 3-(diethylsulfamoyl)benzenesulfonyl chloride. InChIKey: DZRBXDUYMSHEHG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO4S2
Molecular weight311.8 g/mol
IUPAC name3-(diethylsulfamoyl)benzenesulfonyl chloride
InChIKeyDZRBXDUYMSHEHG-UHFFFAOYSA-N
SMILESCCN(CC)S(=O)(=O)C1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)