Products 1016702-60-5

CAS 1016702-60-5 appears in our catalog under these names: 4-(Butylsulfamoyl)benzene-1-sulfonyl chloride, 95%, 4-(Butylsulfamoyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

4-(butylsulfamoyl)benzenesulfonyl chloride (CAS 1016702-60-5) is a chemical compound with the molecular formula C10H14ClNO4S2 and a molecular weight of 311.8 g/mol. IUPAC name: 4-(butylsulfamoyl)benzenesulfonyl chloride. InChIKey: GSUXHKNRDYDALW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO4S2
Molecular weight311.8 g/mol
IUPAC name4-(butylsulfamoyl)benzenesulfonyl chloride
InChIKeyGSUXHKNRDYDALW-UHFFFAOYSA-N
SMILESCCCCNS(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)