CAS 1017442-54-4 is the registry number for 2-(4-(N,N-Dimethylsulfamoyl)phenyl)ethane-1-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-[4-(dimethylsulfamoyl)phenyl]ethanesulfonyl chloride (CAS 1017442-54-4) is a chemical compound with the molecular formula C10H14ClNO4S2 and a molecular weight of 311.8 g/mol. IUPAC name: 2-[4-(dimethylsulfamoyl)phenyl]ethanesulfonyl chloride. InChIKey: QWKCEFUTHYJYSZ-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO4S2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 2-[4-(dimethylsulfamoyl)phenyl]ethanesulfonyl chloride |
| InChIKey | QWKCEFUTHYJYSZ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)CCS(=O)(=O)Cl |
Computed by PubChem (NCBI)