CAS 101671-27-6 is the registry number for (3E)-3-(Phenylimino)-1,3-dihydro-2h-indol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-phenylimino-1H-indol-2-one (CAS 101671-27-6) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 3-phenylimino-1H-indol-2-one. InChIKey: XHQFUPTZQYGGHC-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-phenylimino-1H-indol-2-one |
| InChIKey | XHQFUPTZQYGGHC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=C2C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)