CAS 1016741-75-5 appears in our catalog under these names: 4-{imidazo(1,2-a)pyridin-2-ylmethoxy}aniline, 95%, 4-{Imidazo(1,2-a)pyridin-2-ylmethoxy}aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-(imidazo[1,2-a]pyridin-2-ylmethoxy)aniline (CAS 1016741-75-5) is a chemical compound with the molecular formula C14H13N3O and a molecular weight of 239.27 g/mol. IUPAC name: 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)aniline. InChIKey: TVJLDIGGBRVMKH-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)aniline |
| InChIKey | TVJLDIGGBRVMKH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)COC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)