Products 1016810-65-3
CAS 1016810-65-3 is the registry number for 2-Chloro-N-(3,4,5-trimethoxyphenyl)propanamide. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
2-chloro-N-(3,4,5-trimethoxyphenyl)propanamide (CAS 1016810-65-3) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: 2-chloro-N-(3,4,5-trimethoxyphenyl)propanamide. InChIKey: JCHCUMMWUNZOCI-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | 2-chloro-N-(3,4,5-trimethoxyphenyl)propanamide |
| InChIKey | JCHCUMMWUNZOCI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC(=C(C(=C1)OC)OC)OC)Cl |
Computed by PubChem (NCBI)