Products 1016815-19-2
CAS 1016815-19-2 is the registry number for 5,6-Dichloro-N-(prop-2-yn-1-yl)nicotinamide, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
5,6-dichloro-N-prop-2-ynylpyridine-3-carboxamide (CAS 1016815-19-2) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 5,6-dichloro-N-prop-2-ynylpyridine-3-carboxamide. InChIKey: BIXVXMMPGVPYFQ-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 5,6-dichloro-N-prop-2-ynylpyridine-3-carboxamide |
| InChIKey | BIXVXMMPGVPYFQ-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)C1=CC(=C(N=C1)Cl)Cl |
Computed by PubChem (NCBI)