CAS 1016860-91-5 appears in our catalog under these names: 2-(1-Oxophthalazin-2(1H)-yl)ethanethioamide, 98%, 2-(1-Oxo-1,2-dihydrophthalazin-2-yl)ethanethioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 2,5g.
2-(1-oxophthalazin-2-yl)ethanethioamide (CAS 1016860-91-5) is a chemical compound with the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. IUPAC name: 2-(1-oxophthalazin-2-yl)ethanethioamide. InChIKey: FKUQQTYKBFFCON-UHFFFAOYSA-N.
| Molecular formula | C10H9N3OS |
|---|---|
| Molecular weight | 219.27 g/mol |
| IUPAC name | 2-(1-oxophthalazin-2-yl)ethanethioamide |
| InChIKey | FKUQQTYKBFFCON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN(C2=O)CC(=S)N |
Computed by PubChem (NCBI)