CAS 27623-05-8 is the registry number for 6-(4-Methylphenyl)-3-thioxo-3,4-dihydro-1,2,4-triazin-5(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
6-(4-methylphenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one (CAS 27623-05-8) is a chemical compound with the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. IUPAC name: 6-(4-methylphenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one. InChIKey: ZHWHQITXIZRAGM-UHFFFAOYSA-N.
| Molecular formula | C10H9N3OS |
|---|---|
| Molecular weight | 219.27 g/mol |
| IUPAC name | 6-(4-methylphenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| InChIKey | ZHWHQITXIZRAGM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=S)NC2=O |
Computed by PubChem (NCBI)