CAS 709000-51-1 is the registry number for N-Benzyl-1,2,5-thiadiazole-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-1,2,5-thiadiazole-3-carboxamide (CAS 709000-51-1) is a chemical compound with the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. IUPAC name: N-benzyl-1,2,5-thiadiazole-3-carboxamide. InChIKey: WYZDZWYFLWYAHW-UHFFFAOYSA-N.
| Molecular formula | C10H9N3OS |
|---|---|
| Molecular weight | 219.27 g/mol |
| IUPAC name | N-benzyl-1,2,5-thiadiazole-3-carboxamide |
| InChIKey | WYZDZWYFLWYAHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=NSN=C2 |
Computed by PubChem (NCBI)