CAS 1247133-10-3 is the registry number for 5-(2,3-Dihydrobenzofuran-5-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4-thiadiazol-2-amine (CAS 1247133-10-3) is a chemical compound with the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. IUPAC name: 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4-thiadiazol-2-amine. InChIKey: WMMSCGUNHYOJOG-UHFFFAOYSA-N.
| Molecular formula | C10H9N3OS |
|---|---|
| Molecular weight | 219.27 g/mol |
| IUPAC name | 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | WMMSCGUNHYOJOG-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)