CAS 1248217-59-5 is the registry number for 2-Hydrazinyl-4H-chromeno[4,3-d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4H-chromeno[4,3-d][1,3]thiazol-2-ylhydrazine (CAS 1248217-59-5) is a chemical compound with the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. IUPAC name: 4H-chromeno[4,3-d][1,3]thiazol-2-ylhydrazine. InChIKey: YQTUVCVGYXSQKN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3OS |
|---|---|
| Molecular weight | 219.27 g/mol |
| IUPAC name | 4H-chromeno[4,3-d][1,3]thiazol-2-ylhydrazine |
| InChIKey | YQTUVCVGYXSQKN-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C3O1)N=C(S2)NN |
Computed by PubChem (NCBI)