CAS 1260008-78-3 is the registry number for 1-Benzothiazol-6-yl-imidazolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(1,3-benzothiazol-6-yl)imidazolidin-2-one (CAS 1260008-78-3) is a chemical compound with the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. IUPAC name: 1-(1,3-benzothiazol-6-yl)imidazolidin-2-one. InChIKey: MOXQDTRQWCBEDW-UHFFFAOYSA-N.
| Molecular formula | C10H9N3OS |
|---|---|
| Molecular weight | 219.27 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-6-yl)imidazolidin-2-one |
| InChIKey | MOXQDTRQWCBEDW-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)N1)C2=CC3=C(C=C2)N=CS3 |
Computed by PubChem (NCBI)