CAS 101693-73-6 appears in our catalog under these names: (5R)-5-Methyl-5-phenylimidazolidine-2,4-dione, 95%, (5R)-5-Methyl-5-phenylimidazolidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 10mg, 25mg, 50mg.
(5R)-5-methyl-5-phenylimidazolidine-2,4-dione (CAS 101693-73-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: (5R)-5-methyl-5-phenylimidazolidine-2,4-dione. InChIKey: JNGWGQUYLVSFND-SNVBAGLBSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | (5R)-5-methyl-5-phenylimidazolidine-2,4-dione |
| InChIKey | JNGWGQUYLVSFND-SNVBAGLBSA-N |
| SMILES | C[C@]1(C(=O)NC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)