Products 27539-12-4
CAS 27539-12-4 appears in our catalog under these names: (S)-5-Methyl-5-phenylhydantoin, (S)-5-Methyl-5-phenylimidazolidine-2,4-dione, 97%, (S)-5-Methyl-5-phenylimidazolidine-2,4-dione 95%. Offered by: TRC, AmBeed. Available pack sizes: 2,5g, 1g, 50mg, 100mg, 5mg, 10mg, 25mg.
(5S)-5-methyl-5-phenylimidazolidine-2,4-dione (CAS 27539-12-4) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: (5S)-5-methyl-5-phenylimidazolidine-2,4-dione. InChIKey: JNGWGQUYLVSFND-JTQLQIEISA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | (5S)-5-methyl-5-phenylimidazolidine-2,4-dione |
| InChIKey | JNGWGQUYLVSFND-JTQLQIEISA-N |
| SMILES | C[C@@]1(C(=O)NC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)