CAS 1017060-58-0 appears in our catalog under these names: 3,4-Dihydroxy-2-nitrobenzyl alcohol, 95%, 3,4-Dihydroxy-2-nitrobenzyl alcohol, 3,4-Dihydroxy-2-nitrobenzyl alcohol, min. 95 %, 5 g, 3,4-Dihydroxy-2-nitrobenzyl alcohol, min. 95 %, 10 g, 3,4-Dihydroxy-2-nitrobenzyl alcohol, min. 95 %, 25 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 10g, 1g, 25g, 5g.
4-(hydroxymethyl)-3-nitrobenzene-1,2-diol (CAS 1017060-58-0) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: 4-(hydroxymethyl)-3-nitrobenzene-1,2-diol. InChIKey: OLAYODWDHPTDGW-UHFFFAOYSA-N.
| Molecular formula | C7H7NO5 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 4-(hydroxymethyl)-3-nitrobenzene-1,2-diol |
| InChIKey | OLAYODWDHPTDGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CO)[N+](=O)[O-])O)O |
Computed by PubChem (NCBI)