CAS 72030-81-0 is the registry number for Dimethyl oxazole-4,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
Dimethyl 1,3-oxazole-4,5-dicarboxylate (CAS 72030-81-0) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: dimethyl 1,3-oxazole-4,5-dicarboxylate. InChIKey: LYRDBSFJJDATFO-UHFFFAOYSA-N.
| Molecular formula | C7H7NO5 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | dimethyl 1,3-oxazole-4,5-dicarboxylate |
| InChIKey | LYRDBSFJJDATFO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(OC=N1)C(=O)OC |
Computed by PubChem (NCBI)