Products 72030-81-0

CAS 72030-81-0 is the registry number for Dimethyl oxazole-4,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 1,3-oxazole-4,5-dicarboxylate (CAS 72030-81-0) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: dimethyl 1,3-oxazole-4,5-dicarboxylate. InChIKey: LYRDBSFJJDATFO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO5
Molecular weight185.13 g/mol
IUPAC namedimethyl 1,3-oxazole-4,5-dicarboxylate
InChIKeyLYRDBSFJJDATFO-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(OC=N1)C(=O)OC

Computed by PubChem (NCBI)