Products 857821-36-4

CAS 857821-36-4 is the registry number for 2,5-Dimethyl-4-nitrofuran-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,5-dimethyl-4-nitrofuran-3-carboxylic acid (CAS 857821-36-4) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: 2,5-dimethyl-4-nitrofuran-3-carboxylic acid. InChIKey: PJJKRUQMCSHPEI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO5
Molecular weight185.13 g/mol
IUPAC name2,5-dimethyl-4-nitrofuran-3-carboxylic acid
InChIKeyPJJKRUQMCSHPEI-UHFFFAOYSA-N
SMILESCC1=C(C(=C(O1)C)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)