Products 2092185-52-7

CAS 2092185-52-7 is the registry number for 5-(3-Hydroxyoxetan-3-yl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-(3-hydroxyoxetan-3-yl)-1,2-oxazole-3-carboxylic acid (CAS 2092185-52-7) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: 5-(3-hydroxyoxetan-3-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: OGIJCQAQBQASMU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO5
Molecular weight185.13 g/mol
IUPAC name5-(3-hydroxyoxetan-3-yl)-1,2-oxazole-3-carboxylic acid
InChIKeyOGIJCQAQBQASMU-UHFFFAOYSA-N
SMILESC1C(CO1)(C2=CC(=NO2)C(=O)O)O

Computed by PubChem (NCBI)