CAS 1894411-63-2 is the registry number for 5-(Ethoxycarbonyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethoxycarbonyl-1,2-oxazole-3-carboxylic acid (CAS 1894411-63-2) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: 5-ethoxycarbonyl-1,2-oxazole-3-carboxylic acid. InChIKey: XGFPMOOIDXGOAP-UHFFFAOYSA-N.
| Molecular formula | C7H7NO5 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 5-ethoxycarbonyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | XGFPMOOIDXGOAP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NO1)C(=O)O |
Computed by PubChem (NCBI)