Products 1894411-63-2

CAS 1894411-63-2 is the registry number for 5-(Ethoxycarbonyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-ethoxycarbonyl-1,2-oxazole-3-carboxylic acid (CAS 1894411-63-2) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: 5-ethoxycarbonyl-1,2-oxazole-3-carboxylic acid. InChIKey: XGFPMOOIDXGOAP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO5
Molecular weight185.13 g/mol
IUPAC name5-ethoxycarbonyl-1,2-oxazole-3-carboxylic acid
InChIKeyXGFPMOOIDXGOAP-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=NO1)C(=O)O

Computed by PubChem (NCBI)