CAS 133674-44-9 is the registry number for 3-(Ethoxycarbonyl)-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-ethoxycarbonyl-1,2-oxazole-5-carboxylic acid (CAS 133674-44-9) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: 3-ethoxycarbonyl-1,2-oxazole-5-carboxylic acid. InChIKey: YICMWFKVBQBQDL-UHFFFAOYSA-N.
| Molecular formula | C7H7NO5 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 3-ethoxycarbonyl-1,2-oxazole-5-carboxylic acid |
| InChIKey | YICMWFKVBQBQDL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C(=O)O |
Computed by PubChem (NCBI)