Products 101708-63-8
CAS 101708-63-8 is the registry number for (R,S)-Norcotinine N-Oxide. Offered by: TRC. Available pack sizes: 250mg.
5-(1-oxidopyridin-1-ium-3-yl)pyrrolidin-2-one (CAS 101708-63-8) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 5-(1-oxidopyridin-1-ium-3-yl)pyrrolidin-2-one. InChIKey: QLOVMRAJVDCTAF-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 5-(1-oxidopyridin-1-ium-3-yl)pyrrolidin-2-one |
| InChIKey | QLOVMRAJVDCTAF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC1C2=C[N+](=CC=C2)[O-] |
Computed by PubChem (NCBI)