CAS 1017161-83-9 is the registry number for [(2,3-Dimethylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2,3-dimethylimidazo[2,1-b][1,3]thiazol-6-yl)methanamine;dihydrochloride (CAS 1017161-83-9) is a chemical compound with the molecular formula C8H13Cl2N3S and a molecular weight of 254.18 g/mol. IUPAC name: (2,3-dimethylimidazo[2,1-b][1,3]thiazol-6-yl)methanamine;dihydrochloride. InChIKey: FSONFIOYINNQTP-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3S |
|---|---|
| Molecular weight | 254.18 g/mol |
| IUPAC name | (2,3-dimethylimidazo[2,1-b][1,3]thiazol-6-yl)methanamine;dihydrochloride |
| InChIKey | FSONFIOYINNQTP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=CN12)CN)C.Cl.Cl |
Computed by PubChem (NCBI)