CAS 1177280-81-7 appears in our catalog under these names: 2-(3-Methylimidazo[2,1-b][1,3]thiazol-6-yl)ethanamine dihydrochloride, 95%, 2-(3-MEthylimidazo(2,1-b)(1,3)thiazol-6-yl)ethanamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)ethanamine;dihydrochloride (CAS 1177280-81-7) is a chemical compound with the molecular formula C8H13Cl2N3S and a molecular weight of 254.18 g/mol. IUPAC name: 2-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)ethanamine;dihydrochloride. InChIKey: ALMFCTCNGBPTAD-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3S |
|---|---|
| Molecular weight | 254.18 g/mol |
| IUPAC name | 2-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)ethanamine;dihydrochloride |
| InChIKey | ALMFCTCNGBPTAD-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=NC(=CN12)CCN.Cl.Cl |
Computed by PubChem (NCBI)