CAS 1332529-24-4 appears in our catalog under these names: (2-Imidazo[2,1-b][1,3]thiazol-6-yl-1-methylethyl)amine dihydrochloride, 95%, 1-(Imidazo(2,1-b)thiazol-6-yl)propan-2-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
1-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-amine;dihydrochloride (CAS 1332529-24-4) is a chemical compound with the molecular formula C8H13Cl2N3S and a molecular weight of 254.18 g/mol. IUPAC name: 1-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-amine;dihydrochloride. InChIKey: INXBAGBCEXYOME-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3S |
|---|---|
| Molecular weight | 254.18 g/mol |
| IUPAC name | 1-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-amine;dihydrochloride |
| InChIKey | INXBAGBCEXYOME-UHFFFAOYSA-N |
| SMILES | CC(CC1=CN2C=CSC2=N1)N.Cl.Cl |
Computed by PubChem (NCBI)