CAS 1258650-30-4 is the registry number for Methyl({6-methylimidazo(2,1-b)(1,3)thiazol-5-yl}methyl)amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride (CAS 1258650-30-4) is a chemical compound with the molecular formula C8H13Cl2N3S and a molecular weight of 254.18 g/mol. IUPAC name: N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride. InChIKey: NSUOGXODVZIXJM-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3S |
|---|---|
| Molecular weight | 254.18 g/mol |
| IUPAC name | N-methyl-1-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride |
| InChIKey | NSUOGXODVZIXJM-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=CSC2=N1)CNC.Cl.Cl |
Computed by PubChem (NCBI)