CAS 1255306-05-8 is the registry number for (1-Imidazo[2,1-b][1,3]thiazol-6-ylpropyl)amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-imidazo[2,1-b][1,3]thiazol-6-ylpropan-1-amine;dihydrochloride (CAS 1255306-05-8) is a chemical compound with the molecular formula C8H13Cl2N3S and a molecular weight of 254.18 g/mol. IUPAC name: 1-imidazo[2,1-b][1,3]thiazol-6-ylpropan-1-amine;dihydrochloride. InChIKey: IZAHNTMLBZDQBO-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3S |
|---|---|
| Molecular weight | 254.18 g/mol |
| IUPAC name | 1-imidazo[2,1-b][1,3]thiazol-6-ylpropan-1-amine;dihydrochloride |
| InChIKey | IZAHNTMLBZDQBO-UHFFFAOYSA-N |
| SMILES | CCC(C1=CN2C=CSC2=N1)N.Cl.Cl |
Computed by PubChem (NCBI)