CAS 1820735-56-5 is the registry number for {2,6-Dimethylimidazo(2,1-b)(1,3)thiazol-5-yl}methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride (CAS 1820735-56-5) is a chemical compound with the molecular formula C8H13Cl2N3S and a molecular weight of 254.18 g/mol. IUPAC name: (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride. InChIKey: LFKBJCKIMQUIAC-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3S |
|---|---|
| Molecular weight | 254.18 g/mol |
| IUPAC name | (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine;dihydrochloride |
| InChIKey | LFKBJCKIMQUIAC-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(N=C2S1)C)CN.Cl.Cl |
Computed by PubChem (NCBI)