CAS 945389-25-3 is the registry number for 7-Chloro-5-fluoro-3,4-dihydronaphthalen-1(2H)-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-chloro-5-fluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 945389-25-3) is a chemical compound with the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. IUPAC name: 7-chloro-5-fluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: QTASVQLMUBSTRB-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO |
|---|---|
| Molecular weight | 198.62 g/mol |
| IUPAC name | 7-chloro-5-fluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | QTASVQLMUBSTRB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2F)Cl)C(=O)C1 |
Computed by PubChem (NCBI)