Products 898790-24-4
CAS 898790-24-4 appears in our catalog under these names: 4-Chloro-2-fluorophenyl cyclopropyl ketone, 98%, 4-Chloro-2-fluorophenyl cyclopropyl ketone, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-chloro-2-fluorophenyl)-cyclopropylmethanone (CAS 898790-24-4) is a chemical compound with the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. IUPAC name: (4-chloro-2-fluorophenyl)-cyclopropylmethanone. InChIKey: YXKWPFIGAHBKIM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO |
|---|---|
| Molecular weight | 198.62 g/mol |
| IUPAC name | (4-chloro-2-fluorophenyl)-cyclopropylmethanone |
| InChIKey | YXKWPFIGAHBKIM-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=C(C=C(C=C2)Cl)F |
Computed by PubChem (NCBI)