Products 745784-67-2
CAS 745784-67-2 is the registry number for 8-Chloro-6-fluoro-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-6-fluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 745784-67-2) is a chemical compound with the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. IUPAC name: 8-chloro-6-fluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: XIGFBPGGDJEPPC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO |
|---|---|
| Molecular weight | 198.62 g/mol |
| IUPAC name | 8-chloro-6-fluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | XIGFBPGGDJEPPC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC(=C2)F)Cl |
Computed by PubChem (NCBI)