CAS 745784-68-3 is the registry number for 6-Chloro-8-fluoro-3,4-dihydronaphthalen-1(2H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-8-fluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 745784-68-3) is a chemical compound with the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. IUPAC name: 6-chloro-8-fluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: ZBYTWFVWOCJGRZ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO |
|---|---|
| Molecular weight | 198.62 g/mol |
| IUPAC name | 6-chloro-8-fluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | ZBYTWFVWOCJGRZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC(=C2)Cl)F |
Computed by PubChem (NCBI)