Products 1017480-48-6
CAS 1017480-48-6 is the registry number for 1-(2,4-dichlorophenyl)cyclopentan-1-amine, >95%. Offered by: Chemat. Available pack sizes: 100mg.
1-(2,4-dichlorophenyl)cyclopentan-1-amine (CAS 1017480-48-6) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclopentan-1-amine. InChIKey: HGWUSLGLFJQQOM-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclopentan-1-amine |
| InChIKey | HGWUSLGLFJQQOM-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)