Products 1017590-28-1
CAS 1017590-28-1 is the registry number for 2,5-Dichloropyridine-4-carbonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2,5-dichloropyridine-4-carbonyl chloride (CAS 1017590-28-1) is a chemical compound with the molecular formula C6H2Cl3NO and a molecular weight of 210.4 g/mol. IUPAC name: 2,5-dichloropyridine-4-carbonyl chloride. InChIKey: AHVAQQPGXVFJFQ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO |
|---|---|
| Molecular weight | 210.4 g/mol |
| IUPAC name | 2,5-dichloropyridine-4-carbonyl chloride |
| InChIKey | AHVAQQPGXVFJFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Cl)C(=O)Cl |
Computed by PubChem (NCBI)