CAS 107836-75-9 appears in our catalog under these names: 4,6-Dichloronicotinoyl chloride, 95+%, 4,6-Dichloropyridine-3-carbonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4,6-dichloropyridine-3-carbonyl chloride (CAS 107836-75-9) is a chemical compound with the molecular formula C6H2Cl3NO and a molecular weight of 210.4 g/mol. IUPAC name: 4,6-dichloropyridine-3-carbonyl chloride. InChIKey: UHLHNLZULRWKJR-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO |
|---|---|
| Molecular weight | 210.4 g/mol |
| IUPAC name | 4,6-dichloropyridine-3-carbonyl chloride |
| InChIKey | UHLHNLZULRWKJR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)C(=O)Cl)Cl |
Computed by PubChem (NCBI)