CAS 101768-40-5 is the registry number for 3-[(4-methylbenzene)sulfonyl]pyrrolidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(4-methylphenyl)sulfonylpyrrolidine;hydrochloride (CAS 101768-40-5) is a chemical compound with the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. IUPAC name: 3-(4-methylphenyl)sulfonylpyrrolidine;hydrochloride. InChIKey: KVVYDFUAHPEACJ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2S |
|---|---|
| Molecular weight | 261.77 g/mol |
| IUPAC name | 3-(4-methylphenyl)sulfonylpyrrolidine;hydrochloride |
| InChIKey | KVVYDFUAHPEACJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2CCNC2.Cl |
Computed by PubChem (NCBI)