CAS 1172500-91-2 appears in our catalog under these names: 4–Benzenesulfonylpiperidine Hydrochloride, 4-Benzenesulfonylpiperidine Hydrochloride 95%, 4-Benzenesulfonylpiperidine Hydrochloride, 95%, 95%, 4-BENZENESULFONYLPIPERIDINE HYDROCHLORIDE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-(benzenesulfonyl)piperidine;hydrochloride (CAS 1172500-91-2) is a chemical compound with the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. IUPAC name: 4-(benzenesulfonyl)piperidine;hydrochloride. InChIKey: VHOOEJWBCPRXNM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2S |
|---|---|
| Molecular weight | 261.77 g/mol |
| IUPAC name | 4-(benzenesulfonyl)piperidine;hydrochloride |
| InChIKey | VHOOEJWBCPRXNM-UHFFFAOYSA-N |
| SMILES | C1CNCCC1S(=O)(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)