CAS 5553-26-4 is the registry number for N-Benzyl-n-(1,1-dioxidotetrahydrothien-3-yl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
N-benzyl-1,1-dioxothiolan-3-amine;hydrochloride (CAS 5553-26-4) is a chemical compound with the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. IUPAC name: N-benzyl-1,1-dioxothiolan-3-amine;hydrochloride. InChIKey: MQHJLOORBPGTCO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2S |
|---|---|
| Molecular weight | 261.77 g/mol |
| IUPAC name | N-benzyl-1,1-dioxothiolan-3-amine;hydrochloride |
| InChIKey | MQHJLOORBPGTCO-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)