CAS 1354960-80-7 appears in our catalog under these names: 5-(Piperidin-1-ylmethyl)thiophene-2-carboxylic acid hydrochloride, 95%, 5-(Piperidin-1-ylmethyl)thiophene-2-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-(piperidin-1-ylmethyl)thiophene-2-carboxylic acid;hydrochloride (CAS 1354960-80-7) is a chemical compound with the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. IUPAC name: 5-(piperidin-1-ylmethyl)thiophene-2-carboxylic acid;hydrochloride. InChIKey: BKFMWUJDRISCGU-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2S |
|---|---|
| Molecular weight | 261.77 g/mol |
| IUPAC name | 5-(piperidin-1-ylmethyl)thiophene-2-carboxylic acid;hydrochloride |
| InChIKey | BKFMWUJDRISCGU-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=CC=C(S2)C(=O)O.Cl |
Computed by PubChem (NCBI)