CAS 170112-17-1 appears in our catalog under these names: Methyl (e)-(3s)-3-amino-4-phenylbut-1-enyl sulfone hydrochloride, 95%, (S,E)-4-(Methylsulfonyl)-1-phenylbut-3-en-2-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(E,2S)-4-methylsulfonyl-1-phenylbut-3-en-2-amine;hydrochloride (CAS 170112-17-1) is a chemical compound with the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. IUPAC name: (E,2S)-4-methylsulfonyl-1-phenylbut-3-en-2-amine;hydrochloride. InChIKey: UJCKXQIBITWDIW-JXRCSLTCSA-N.
| Molecular formula | C11H16ClNO2S |
|---|---|
| Molecular weight | 261.77 g/mol |
| IUPAC name | (E,2S)-4-methylsulfonyl-1-phenylbut-3-en-2-amine;hydrochloride |
| InChIKey | UJCKXQIBITWDIW-JXRCSLTCSA-N |
| SMILES | CS(=O)(=O)/C=C/[C@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)