Products 914644-58-9
CAS 914644-58-9 is the registry number for (S)-3-Amino-2-(3-(methylthio)benzyl)propanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(aminomethyl)-3-(3-methylsulfanylphenyl)propanoic acid;hydrochloride (CAS 914644-58-9) is a chemical compound with the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. IUPAC name: (2S)-2-(aminomethyl)-3-(3-methylsulfanylphenyl)propanoic acid;hydrochloride. InChIKey: WKIIBXKPWLWLGF-FVGYRXGTSA-N.
| Molecular formula | C11H16ClNO2S |
|---|---|
| Molecular weight | 261.77 g/mol |
| IUPAC name | (2S)-2-(aminomethyl)-3-(3-methylsulfanylphenyl)propanoic acid;hydrochloride |
| InChIKey | WKIIBXKPWLWLGF-FVGYRXGTSA-N |
| SMILES | CSC1=CC=CC(=C1)C[C@@H](CN)C(=O)O.Cl |
Computed by PubChem (NCBI)