CAS 1017778-44-7 appears in our catalog under these names: 3-Ethoxy-2,4-difluorocinnamic acid, 95%, 3-(3-Ethoxy-2,4-difluorophenyl)acrylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(E)-3-(3-ethoxy-2,4-difluorophenyl)prop-2-enoic acid (CAS 1017778-44-7) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: (E)-3-(3-ethoxy-2,4-difluorophenyl)prop-2-enoic acid. InChIKey: KEKXZPKFJIPTDE-GQCTYLIASA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | (E)-3-(3-ethoxy-2,4-difluorophenyl)prop-2-enoic acid |
| InChIKey | KEKXZPKFJIPTDE-GQCTYLIASA-N |
| SMILES | CCOC1=C(C=CC(=C1F)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)