Products 1248400-97-6
CAS 1248400-97-6 is the registry number for Methyl 4-(2,5-difluorophenyl)-4-oxobutanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 4-(2,5-difluorophenyl)-4-oxobutanoate (CAS 1248400-97-6) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: methyl 4-(2,5-difluorophenyl)-4-oxobutanoate. InChIKey: VQTFRRHQPVCEPJ-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | methyl 4-(2,5-difluorophenyl)-4-oxobutanoate |
| InChIKey | VQTFRRHQPVCEPJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)C1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)