CAS 1630101-15-3 is the registry number for Methyl 2-(4-acetylphenyl)-2,2-difluoroacetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
Methyl 2-(4-acetylphenyl)-2,2-difluoroacetate (CAS 1630101-15-3) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: methyl 2-(4-acetylphenyl)-2,2-difluoroacetate. InChIKey: CWZMEAIUEGRKQL-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | methyl 2-(4-acetylphenyl)-2,2-difluoroacetate |
| InChIKey | CWZMEAIUEGRKQL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C(=O)OC)(F)F |
Computed by PubChem (NCBI)